CMap Candidate Details
Structure:
| CMap ID: | C00422 |
| Pert ID: | BRD-K46386702 |
| Compound Name: | ARRY-334543 |
| Targets: | ERBB2 |
| MoA: | EGFR inhibitor |
| SMILES: | C[C@@H]1COC(Nc2ccc3ncnc(Nc4ccc(OCc5nccs5)c(Cl)c4)c3c2)=N1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 124569 | BRD-K46386702 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124593 | BRD-K46386702 | A549 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124608 | BRD-K46386702 | HA1E | 10 uM | 24 h | 0.26 | 1.07 | 0.19 | 0.0 | 0.0 | 0.0 |
| 124635 | BRD-K46386702 | HEK293 | 0.125 uM | 24 h | 0.2 | 0.85 | 0.01 | 0.0 | 0.0 | 0.0 |
| 124650 | BRD-K46386702 | HELA | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124681 | BRD-K46386702 | HT29 | 10 uM | 24 h | 0.19 | 0.79 | 0.0 | 0.35 | 1.22 | 1.15 |
| 124738 | BRD-K46386702 | MCF10A | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124753 | BRD-K46386702 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124782 | BRD-K46386702 | MDAMB231 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124826 | BRD-K46386702 | PC3 | 10 uM | 24 h | 0.21 | 0.87 | 0.01 | 0.0 | 0.0 | 0.0 |
| 124870 | BRD-K46386702 | THP1 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.27 | -0.91 | 0.3 |
| 124907 | BRD-K46386702 | YAPC | 10 uM | 24 h | -0.18 | -0.75 | 0.0 | 0.0 | 0.0 | 0.0 |
| 132826 | BRD-K46386702 | JURKAT | 0.25 uM | 24 h | -0.2 | -0.83 | 0.0 | -0.26 | -0.88 | 0.25 |