CMap Candidate Details
Structure:
| CMap ID: | C04236 |
| Pert ID: | BRD-K44442813 |
| Compound Name: | pidotimod |
| Targets: | |
| MoA: | interferon receptor agonist; interleukin receptor agonist |
| SMILES: | OC(=O)[C@@H]1CSCN1C(=O)[C@@H]1CCC(=O)N1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 24579 | BRD-K44442813 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.29 | -0.96 | 0.43 |
| 25511 | BRD-K44442813 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.27 | -0.9 | 0.28 |
| 96680 | BRD-K44442813 | PC3 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121587 | BRD-K44442813 | HA1E | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.31 | -1.05 | 0.69 |
| 121629 | BRD-K44442813 | HELA | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121671 | BRD-K44442813 | MCF??7.00 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.3 | -1.0 | 0.52 |
| 121697 | BRD-K44442813 | YAPC | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.39 | -1.31 | 1.71 |
| 129579 | BRD-K44442813 | A375 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129626 | BRD-K44442813 | HT29 | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |