CMap Candidate Details
Structure:
| CMap ID: | C00429 |
| Pert ID: | BRD-A70514680 |
| Compound Name: | articaine |
| Targets: | |
| MoA: | local anesthetic |
| SMILES: | CCCNC(C)C(=O)Nc1c(C)csc1C(=O)OC |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 6682 | BRD-A70514680 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 6951 | BRD-A70514680 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.24 | 0.86 | 0.16 |
| 7258 | BRD-A70514680 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7800 | BRD-A70514680 | HT29 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.34 | -1.13 | 0.98 |
| 8059 | BRD-A70514680 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.24 | -0.82 | 0.15 |
| 8328 | BRD-A70514680 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 8774 | BRD-A70514680 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.36 | -1.21 | 1.24 |
| 100303 | BRD-A70514680 | U2OS | 6.66 uM | 6 h | -0.26 | -1.09 | 0.33 | 0.0 | 0.0 | 0.0 |