CMap Candidate Details
Structure:
| CMap ID: | C04524 |
| Pert ID: | BRD-K40782193 |
| Compound Name: | QX-222 |
| Targets: | |
| MoA: | sodium channel blocker |
| SMILES: | Cc1cccc(C)c1NC(=O)C[N+](C)(C)C |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 6745 | BRD-K40782193 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.34 | -1.15 | 1.07 |
| 6993 | BRD-K40782193 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7314 | BRD-K40782193 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7995 | BRD-K40782193 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 8089 | BRD-K40782193 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 8367 | BRD-K40782193 | PC3 | 10 uM | 24 h | 0.26 | 1.1 | 0.24 | -0.28 | -0.94 | 0.38 |
| 8671 | BRD-K40782193 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.24 | -0.8 | 0.12 |