CMap Candidate Details
Structure:
| CMap ID: | C04540 |
| Pert ID: | BRD-K93123848 |
| Compound Name: | RAF265 |
| Targets: | BRAF |
| MoA: | RAF inhibitor; VEGFR inhibitor |
| SMILES: | Cn1c(Nc2ccc(cc2)C(F)(F)F)nc2cc(Oc3ccnc(c3)-c3ncc([nH]3)C(F)(F)F)ccc12 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 94516 | BRD-K93123848 | ASC | 10 uM | 24 h | -0.24 | -0.99 | 0.13 | -0.31 | -1.05 | 0.7 |
| 94562 | BRD-K93123848 | CD34 | 3.33 uM | 24 h | -0.33 | -1.39 | 1.14 | -0.24 | -0.82 | 0.15 |
| 94608 | BRD-K93123848 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 94700 | BRD-K93123848 | HELA | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.46 | -1.54 | 15.35 |
| 94757 | BRD-K93123848 | HME1 | 3.33 uM | 24 h | 0.24 | 1.0 | 0.1 | -0.32 | -1.07 | 0.76 |
| 94799 | BRD-K93123848 | HT29 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.27 | 0.96 | 0.34 |
| 94849 | BRD-K93123848 | HUVEC | 10 uM | 24 h | 0.22 | 0.93 | 0.05 | -0.25 | -0.83 | 0.17 |
| 95027 | BRD-K93123848 | NEU | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 95093 | BRD-K93123848 | NPC | 10 uM | 24 h | 0.29 | 1.19 | 0.42 | 0.0 | 0.0 | 0.0 |
| 95125 | BRD-K93123848 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 95175 | BRD-K93123848 | SHSY5Y | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 95215 | BRD-K93123848 | SKL | 0.12 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.43 | -1.46 | 15.35 |
| 95284 | BRD-K93123848 | THP1 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.29 | 1.02 | 0.46 |
| 128101 | BRD-K93123848 | A375 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.26 | 0.91 | 0.24 |
| 128202 | BRD-K93123848 | MCF10A | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.37 | -1.25 | 1.35 |
| 128252 | BRD-K93123848 | MCF??7.00 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 128281 | BRD-K93123848 | MDAMB231 | 10 uM | 24 h | 0.29 | 1.22 | 0.48 | -0.29 | -0.96 | 0.43 |
| 135770 | BRD-K93123848 | A549 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 135792 | BRD-K93123848 | HA1E | 2.22 uM | 24 h | 0.2 | 0.85 | 0.01 | -0.27 | -0.92 | 0.34 |
| 135837 | BRD-K93123848 | HEK293 | 0.74 uM | 24 h | 0.22 | 0.93 | 0.05 | -0.3 | -1.0 | 0.54 |
| 135965 | BRD-K93123848 | JURKAT | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.25 | -0.85 | 0.19 |
| 136111 | BRD-K93123848 | YAPC | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |