CMap Candidate Details
Structure:
| CMap ID: | C00462 |
| Pert ID: | BRD-K09757388 |
| Compound Name: | atazanavir |
| Targets: | |
| MoA: | HIV protease inhibitor |
| SMILES: | COC(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)[C@@H](O)CN(Cc1ccc(cc1)-c1ccccn1)NC(=O)[C@@H](NC(=O)OC)C(C)(C)C)C(C)(C)C |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 91194 | BRD-K09757388 | HUH7 | 4 uM | 72 h | 0.0 | 0.0 | 0.0 | -0.24 | -0.79 | 0.11 |
| 97125 | BRD-K09757388 | A375 | 10 uM | 24 h | 0.29 | 1.21 | 0.45 | 0.0 | 0.0 | 0.0 |
| 97194 | BRD-K09757388 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |