CMap Candidate Details
Structure:
| CMap ID: | C04642 |
| Pert ID: | BRD-K19333160 |
| Compound Name: | RKI-1447 |
| Targets: | CDC42BPA|DMPK|LIMK1|MYLK|PAK1|PKN1|ROCK1|ROCK2 |
| MoA: | rho associated kinase inhibitor |
| SMILES: | Oc1cccc(CNC(=O)Nc2nc(cs2)-c2ccncc2)c1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 96844 | BRD-K19333160 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.21 | -0.71 | 0.03 |
| 96923 | BRD-K19333160 | PC3 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |