CMap Candidate Details
Structure:
| CMap ID: | C04702 |
| Pert ID: | BRD-K87048468 |
| Compound Name: | RS-102221 |
| Targets: | HTR2A|HTR2B|HTR2C |
| MoA: | serotonin receptor antagonist |
| SMILES: | COc1cc(OC)c(cc1NS(=O)(=O)c1ccc(cc1)C(F)(F)F)C(=O)CCCCN1CCC2(CC1)NC(=O)NC2=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 2934 | BRD-K87048468 | HA1E | 10 uM | 24 h | 0.27 | 1.14 | 0.32 | 0.0 | 0.0 | 0.0 |
| 3278 | BRD-K87048468 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 3557 | BRD-K87048468 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 3884 | BRD-K87048468 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 39208 | BRD-K87048468 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.33 | 1.17 | 0.92 |
| 39357 | BRD-K87048468 | A549 | 10 uM | 24 h | -0.26 | -1.1 | 0.35 | -0.36 | -1.21 | 1.24 |
| 39802 | BRD-K87048468 | ASC | 10 uM | 24 h | 0.3 | 1.25 | 0.54 | 0.0 | 0.0 | 0.0 |
| 40094 | BRD-K87048468 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 40359 | BRD-K87048468 | HT29 | 10 uM | 6 h | -0.19 | -0.78 | 0.0 | 0.24 | 0.85 | 0.14 |
| 40522 | BRD-K87048468 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 40902 | BRD-K87048468 | NEU | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.28 | 0.98 | 0.37 |
| 41223 | BRD-K87048468 | NPC | 10 uM | 24 h | -0.26 | -1.08 | 0.3 | 0.0 | 0.0 | 0.0 |
| 41562 | BRD-K87048468 | SKB | 10 uM | 24 h | -0.26 | -1.07 | 0.28 | 0.19 | 0.69 | 0.01 |