CMap Candidate Details
Structure:
| CMap ID: | C00483 |
| Pert ID: | BRD-K12040459 |
| Compound Name: | AT7867 |
| Targets: | AKT2|GSK3B|PKIA|PRKACA |
| MoA: | AKT inhibitor |
| SMILES: | Clc1ccc(cc1)C1(CCNCC1)c1ccc(cc1)-c1cn[nH]c1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 91795 | BRD-K12040459 | HS578T | 2.22 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.26 | 0.92 | 0.25 |
| 91874 | BRD-K12040459 | MCF??7.00 | 2.22 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.33 | 1.18 | 1.01 |
| 91957 | BRD-K12040459 | SKBR3 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 92882 | BRD-K12040459 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.32 | 1.15 | 0.88 |
| 92910 | BRD-K12040459 | A549 | 10 uM | 24 h | 0.18 | 0.73 | 0.0 | 0.0 | 0.0 | 0.0 |
| 92966 | BRD-K12040459 | ASC | 10 uM | 24 h | -0.16 | -0.67 | 0.0 | 0.29 | 1.03 | 0.52 |
| 93023 | BRD-K12040459 | CD34 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.27 | -0.91 | 0.31 |
| 93057 | BRD-K12040459 | HA1E | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 93108 | BRD-K12040459 | HEK293 | 0.12 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 93147 | BRD-K12040459 | HELA | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 93191 | BRD-K12040459 | HEPG2 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 93249 | BRD-K12040459 | HUVEC | 10 uM | 24 h | -0.19 | -0.81 | 0.0 | 0.0 | 0.0 | 0.0 |
| 93299 | BRD-K12040459 | JURKAT | 10 uM | 24 h | -0.22 | -0.93 | 0.07 | 0.0 | 0.0 | 0.0 |
| 93335 | BRD-K12040459 | MCF10A | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.28 | 1.0 | 0.42 |
| 93377 | BRD-K12040459 | MDAMB231 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 93433 | BRD-K12040459 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 93464 | BRD-K12040459 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 93522 | BRD-K12040459 | SKL | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.31 | 1.09 | 0.68 |
| 93563 | BRD-K12040459 | THP1 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.3 | -1.01 | 0.58 |
| 93603 | BRD-K12040459 | YAPC | 10 uM | 24 h | -0.22 | -0.9 | 0.04 | 0.38 | 1.35 | 1.72 |