CMap Candidate Details
Structure:
| CMap ID: | C00517 |
| Pert ID: | BRD-K21908111 |
| Compound Name: | AZD1208 |
| Targets: | PIM1|PIM2|PIM3 |
| MoA: | Pim kinase inhibitor |
| SMILES: | N[C@@H]1CCCN(C1)c1c(cccc1-c1ccccc1)\C=C1/SC(=O)NC1=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 96661 | BRD-K21908111 | PC3 | 3.33 uM | 24 h | -0.25 | -1.03 | 0.2 | 0.0 | 0.0 | 0.0 |
| 120946 | BRD-K21908111 | HEK293 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121038 | BRD-K21908111 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.31 | 1.09 | 0.67 |
| 121104 | BRD-K21908111 | YAPC | 0.04 uM | 24 h | 0.28 | 1.18 | 0.39 | 0.0 | 0.0 | 0.0 |
| 129096 | BRD-K21908111 | A375 | 2.22 uM | 24 h | -0.2 | -0.84 | 0.01 | -0.22 | -0.74 | 0.06 |
| 129113 | BRD-K21908111 | A549 | 0.25 uM | 24 h | -0.31 | -1.3 | 0.8 | 0.33 | 1.15 | 0.9 |
| 129131 | BRD-K21908111 | HA1E | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129149 | BRD-K21908111 | HELA | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.37 | -1.25 | 1.35 |
| 129187 | BRD-K21908111 | HT29 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.28 | 1.01 | 0.44 |