CMap Candidate Details
Structure:
| CMap ID: | C00546 |
| Pert ID: | BRD-K37687095 |
| Compound Name: | AZD8330 |
| Targets: | |
| MoA: | MEK inhibitor |
| SMILES: | Cc1cc(C(=O)NOCCO)c(Nc2ccc(I)cc2F)n(C)c1=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 92018 | BRD-K37687095 | BT20 | 3.33 uM | 24 h | -0.16 | -0.66 | 0.0 | 0.0 | 0.0 | 0.0 |
| 92098 | BRD-K37687095 | HCC515 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 92137 | BRD-K37687095 | HS578T | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 92254 | BRD-K37687095 | MCF??7.00 | 0.12 uM | 24 h | -0.16 | -0.69 | 0.0 | -0.26 | -0.87 | 0.24 |
| 92288 | BRD-K37687095 | MDAMB231 | 0.12 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.29 | -0.96 | 0.43 |
| 92365 | BRD-K37687095 | SKBR3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 95302 | BRD-K37687095 | A549 | 10 uM | 24 h | 0.23 | 0.96 | 0.08 | 0.31 | 1.08 | 0.67 |
| 95417 | BRD-K37687095 | U2OS | 10 uM | 48 h | 0.22 | 0.9 | 0.02 | 0.34 | 1.19 | 1.01 |
| 97329 | BRD-K37687095 | HAP1 | 0.66 uM | 24 h | -0.3 | -1.27 | 0.74 | 0.0 | 0.0 | 0.0 |
| 123524 | BRD-K37687095 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.32 | 1.12 | 0.76 |
| 123591 | BRD-K37687095 | HEK293 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.31 | 1.1 | 0.69 |
| 123627 | BRD-K37687095 | HELA | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.38 | 1.36 | 1.72 |
| 123706 | BRD-K37687095 | MCF10A | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 123747 | BRD-K37687095 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 132021 | BRD-K37687095 | HA1E | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 132064 | BRD-K37687095 | HT29 | 0.25 uM | 24 h | -0.15 | -0.63 | 0.0 | 0.0 | 0.0 | 0.0 |
| 132148 | BRD-K37687095 | YAPC | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.34 | 1.22 | 1.15 |