CMap Candidate Details
                      
                      Structure:
                         
                      
                  
                  | CMap ID: | C00561 | 
| Pert ID: | BRD-K51329597 | 
| Compound Name: | AZM-475271 | 
| Targets: | SRC | 
| MoA: | src inhibitor | 
| SMILES: | COc1ccc(Cl)c(Nc2ncnc3cc(OCC4CCN(C)CC4)c(OC)cc23)c1 | 
| InchiKey: | |
| Compound Aliases: | 
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) | 
|---|
 
    