CMap Candidate Details
                      
                      Structure:
                         
                      
                  
                  | CMap ID: | C00577 | 
| Pert ID: | BRD-A78952587 | 
| Compound Name: | A740003 | 
| Targets: | P2RX7 | 
| MoA: | purinergic receptor antagonist | 
| SMILES: | COc1ccc(CC(=O)NC(N\C(Nc2cccc3ncccc23)=N\C#N)C(C)(C)C)cc1OC | 
| InchiKey: | |
| Compound Aliases: | 
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) | 
|---|---|---|---|---|---|---|---|---|---|---|
| 97139 | BRD-A78952587 | A375 | 10 uM | 24 h | 0.2 | 0.84 | 0.0 | 0.0 | 0.0 | 0.0 | 
| 97206 | BRD-A78952587 | PC3 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 
 
    