CMap Candidate Details
Structure:
| CMap ID: | C05806 |
| Pert ID: | BRD-K54640016 |
| Compound Name: | WAY-362450 |
| Targets: | NR1H4 |
| MoA: | FXR agonist |
| SMILES: | CC(C)OC(=O)C1=CN(CC(C)(C)c2c1[nH]c1ccccc21)C(=O)c1ccc(F)c(F)c1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 90450 | BRD-K54640016 | HL60 | 10 uM | 2 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121566 | BRD-K54640016 | A375 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.18 | -0.62 | 0.0 |
| 121608 | BRD-K54640016 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129608 | BRD-K54640016 | HELA | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129641 | BRD-K54640016 | HT29 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129664 | BRD-K54640016 | MCF??7.00 | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129698 | BRD-K54640016 | PC3 | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129732 | BRD-K54640016 | YAPC | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.33 | -1.11 | 0.9 |