CMap Candidate Details
Structure:
| CMap ID: | C00629 |
| Pert ID: | BRD-K17008822 |
| Compound Name: | BD-1008 |
| Targets: | |
| MoA: | sigma receptor antagonist |
| SMILES: | CN(CCN1CCCC1)CCc1ccc(Cl)c(Cl)c1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 1745 | BRD-K17008822 | HA1E | 10 uM | 6 h | -0.32 | -1.34 | 0.96 | 0.0 | 0.0 | 0.0 |
| 1898 | BRD-K17008822 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 2382 | BRD-K17008822 | PC3 | 10 uM | 6 h | 0.24 | 0.98 | 0.09 | -0.27 | -0.91 | 0.31 |
| 2579 | BRD-K17008822 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 42072 | BRD-K17008822 | A549 | 10 uM | 6 h | 0.22 | 0.9 | 0.02 | 0.0 | 0.0 | 0.0 |
| 42317 | BRD-K17008822 | ASC | 10 uM | 24 h | 0.25 | 1.05 | 0.16 | 0.38 | 1.34 | 1.72 |
| 42648 | BRD-K17008822 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 42951 | BRD-K17008822 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 43304 | BRD-K17008822 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 43508 | BRD-K17008822 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.43 | -1.44 | 15.35 |
| 43807 | BRD-K17008822 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.23 | 0.81 | 0.09 |
| 44084 | BRD-K17008822 | SKB | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |