CMap Candidate Details
Structure:
| CMap ID: | C00688 |
| Pert ID: | BRD-K98624455 |
| Compound Name: | bepotastine |
| Targets: | HRH1 |
| MoA: | histamine receptor antagonist |
| SMILES: | OC(=O)CCCN1CCC(CC1)O[C@@H](c1ccc(Cl)cc1)c1ccccn1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 127339 | BRD-K98624455 | A375 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.26 | -0.88 | 0.25 |
| 127413 | BRD-K98624455 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.26 | 0.91 | 0.23 |
| 127485 | BRD-K98624455 | HT29 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127500 | BRD-K98624455 | JURKAT | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127568 | BRD-K98624455 | MCF??7.00 | 3.33 uM | 24 h | -0.19 | -0.79 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127594 | BRD-K98624455 | PC3 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127670 | BRD-K98624455 | YAPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.27 | 0.95 | 0.32 |
| 135341 | BRD-K98624455 | A549 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.27 | -0.89 | 0.27 |
| 135361 | BRD-K98624455 | HELA | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.25 | -0.83 | 0.17 |
| 135430 | BRD-K98624455 | MCF10A | 2.22 uM | 24 h | -0.26 | -1.1 | 0.34 | 0.0 | 0.0 | 0.0 |
| 135492 | BRD-K98624455 | THP1 | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |