CMap Candidate Details
Structure:
| CMap ID: | C00766 |
| Pert ID: | BRD-A89175223 |
| Compound Name: | bisoprolol |
| Targets: | ADRB1|ADRB2 |
| MoA: | adrenergic receptor antagonist |
| SMILES: | CC(C)NCC(O)COc1ccc(COCCOC(C)C)cc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 5559 | BRD-A89175223 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 25310 | BRD-A89175223 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.26 | -0.88 | 0.24 |
| 37562 | BRD-A89175223 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.27 | -0.92 | 0.33 |
| 37861 | BRD-A89175223 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.42 | -1.4 | 2.02 |
| 38403 | BRD-A89175223 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 38894 | BRD-A89175223 | SKB | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127349 | BRD-A89175223 | A375 | 0.125 uM | 24 h | -0.23 | -0.96 | 0.1 | 0.0 | 0.0 | 0.0 |
| 127389 | BRD-A89175223 | A549 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127422 | BRD-A89175223 | HA1E | 0.04 uM | 24 h | -0.21 | -0.89 | 0.04 | 0.0 | 0.0 | 0.0 |
| 127463 | BRD-A89175223 | HELA | 3.33 uM | 24 h | 0.28 | 1.16 | 0.36 | 0.0 | 0.0 | 0.0 |
| 127512 | BRD-A89175223 | JURKAT | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127572 | BRD-A89175223 | MCF??7.00 | 1.11 uM | 24 h | -0.29 | -1.19 | 0.55 | 0.0 | 0.0 | 0.0 |
| 127604 | BRD-A89175223 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127644 | BRD-A89175223 | THP1 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127682 | BRD-A89175223 | YAPC | 0.125 uM | 24 h | -0.18 | -0.76 | 0.0 | 0.27 | 0.96 | 0.34 |
| 135399 | BRD-A89175223 | HT29 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.37 | -1.26 | 1.35 |
| 135437 | BRD-A89175223 | MCF10A | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.35 | 1.22 | 1.18 |