CMap Candidate Details
Structure:
| CMap ID: | C00767 |
| Pert ID: | BRD-K41494493 |
| Compound Name: | bisphenol-a |
| Targets: | AR|ESR1|ESR2|ESRRG|PPARG |
| MoA: | synthetic estrogen |
| SMILES: | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 52404 | BRD-K41494493 | HA1E | 10 uM | 6 h | -0.22 | -0.91 | 0.05 | -0.27 | -0.91 | 0.3 |
| 52486 | BRD-K41494493 | PC3 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 52598 | BRD-K41494493 | A549 | 6.66 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 53026 | BRD-K41494493 | HEPG2 | 100 uM | 48 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 53154 | BRD-K41494493 | MCF10A | 100 uM | 48 h | -0.19 | -0.78 | 0.0 | -0.27 | -0.9 | 0.29 |