CMap Candidate Details
Structure:
| CMap ID: | C00785 |
| Pert ID: | BRD-K56509348 |
| Compound Name: | BMS-182874 |
| Targets: | EDNRA |
| MoA: | endothelin receptor antagonist |
| SMILES: | CN(C)c1cccc2c(cccc12)S(=O)(=O)Nc1onc(C)c1C |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 6896 | BRD-K56509348 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7183 | BRD-K56509348 | A549 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7472 | BRD-K56509348 | HA1E | 10 uM | 6 h | -0.21 | -0.88 | 0.03 | 0.0 | 0.0 | 0.0 |
| 7695 | BRD-K56509348 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.3 | -1.02 | 0.61 |
| 7900 | BRD-K56509348 | HT29 | 10 uM | 24 h | -0.25 | -1.05 | 0.24 | -0.16 | -0.53 | 0.0 |
| 8108 | BRD-K56509348 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 8524 | BRD-K56509348 | PC3 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.35 | -1.18 | 1.14 |
| 8836 | BRD-K56509348 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 99681 | BRD-K56509348 | U2OS | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |