CMap Candidate Details
Structure:
| CMap ID: | C00819 |
| Pert ID: | BRD-A07563059 |
| Compound Name: | bopindolol |
| Targets: | ADRB1|ADRB2|ADRB3|HTR1A|HTR1B |
| MoA: | adrenergic receptor antagonist |
| SMILES: | Cc1cc2c(OCC(CNC(C)(C)C)OC(=O)c3ccccc3)cccc2[nH]1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 91175 | BRD-A07563059 | HUH7 | 8 uM | 72 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 122555 | BRD-A07563059 | A375 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.32 | -1.07 | 0.76 |
| 122686 | BRD-A07563059 | HT29 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 122733 | BRD-A07563059 | MCF10A | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.36 | -1.22 | 1.24 |
| 122776 | BRD-A07563059 | MDAMB231 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.22 | -0.74 | 0.05 |
| 122800 | BRD-A07563059 | PC3 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.28 | 0.99 | 0.41 |
| 122821 | BRD-A07563059 | YAPC | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130890 | BRD-A07563059 | A549 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.34 | -1.13 | 1.0 |
| 130921 | BRD-A07563059 | HA1E | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.24 | -0.82 | 0.14 |
| 130941 | BRD-A07563059 | HEK293 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130975 | BRD-A07563059 | HELA | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 131055 | BRD-A07563059 | HUVEC | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 131090 | BRD-A07563059 | MCF??7.00 | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |