CMap Candidate Details
Structure:
| CMap ID: | C00823 |
| Pert ID: | BRD-K74763371 |
| Compound Name: | bosentan |
| Targets: | EDNRA|EDNRB |
| MoA: | endothelin receptor antagonist |
| SMILES: | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(cc2)C(C)(C)C)nc(nc1OCCO)-c1ncccn1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 51177 | BRD-K74763371 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 91452 | BRD-K74763371 | HUH7 | 6.66 uM | 72 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127013 | BRD-K74763371 | A375 | 3.33 uM | 24 h | -0.26 | -1.09 | 0.31 | 0.0 | 0.0 | 0.0 |
| 127093 | BRD-K74763371 | HELA | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127131 | BRD-K74763371 | HT29 | 3.33 uM | 24 h | -0.17 | -0.71 | 0.0 | 0.33 | 1.16 | 0.9 |
| 127205 | BRD-K74763371 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.26 | -0.88 | 0.26 |
| 127232 | BRD-K74763371 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127307 | BRD-K74763371 | YAPC | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 135035 | BRD-K74763371 | A549 | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.29 | 1.04 | 0.54 |
| 135078 | BRD-K74763371 | HA1E | 0.01 uM | 24 h | 0.25 | 1.05 | 0.16 | 0.0 | 0.0 | 0.0 |
| 135101 | BRD-K74763371 | HEK293 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.2 | 0.71 | 0.02 |
| 135165 | BRD-K74763371 | JURKAT | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.48 | -1.6 | 15.65 |
| 135200 | BRD-K74763371 | MCF10A | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 135254 | BRD-K74763371 | MDAMB231 | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.27 | 0.96 | 0.33 |
| 135303 | BRD-K74763371 | THP1 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |