CMap Candidate Details
Structure:
| CMap ID: | C00835 |
| Pert ID: | BRD-K96123349 |
| Compound Name: | brequinar |
| Targets: | DHODH |
| MoA: | dihydroorotate dehydrogenase inhibitor |
| SMILES: | Cc1c(nc2ccc(F)cc2c1C(O)=O)-c1ccc(cc1)-c1ccccc1F |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 88075 | BRD-K96123349 | MCF??7.00 | 4 uM | 24 h | -0.19 | -0.79 | 0.0 | 0.0 | 0.0 | 0.0 |
| 128391 | BRD-K96123349 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 128448 | BRD-K96123349 | HEK293 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.25 | 0.88 | 0.19 |
| 128509 | BRD-K96123349 | HT29 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 128558 | BRD-K96123349 | JURKAT | 10 uM | 24 h | -0.16 | -0.66 | 0.0 | 0.33 | 1.16 | 0.9 |
| 128598 | BRD-K96123349 | MCF10A | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 128650 | BRD-K96123349 | MDAMB231 | 3.33 uM | 24 h | 0.17 | 0.72 | 0.0 | 0.32 | 1.14 | 0.86 |
| 128685 | BRD-K96123349 | PC3 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 128730 | BRD-K96123349 | THP1 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 128775 | BRD-K96123349 | YAPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 136187 | BRD-K96123349 | A375 | 0.08 uM | 24 h | 0.22 | 0.92 | 0.04 | 0.27 | 0.96 | 0.34 |
| 136233 | BRD-K96123349 | HA1E | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.34 | -1.13 | 0.98 |
| 136268 | BRD-K96123349 | HELA | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.22 | 0.78 | 0.07 |