CMap Candidate Details
Structure:
| CMap ID: | C00908 |
| Pert ID: | BRD-K71350836 |
| Compound Name: | butalbital |
| Targets: | CHRNA4|CHRNA7|GABRA1|GABRA2|GABRA3|GABRA4|GABRA5|GABRA6|GABRB1|GABRB2|GABRB3|GABRD|GABRE|GABRG1|GABRG2|GABRG3|GABRP|GABRQ|GRIA2|GRIK2 |
| MoA: | GABA receptor antagonist |
| SMILES: | CC(C)CC1(CC=C)C(=O)NC(=O)NC1=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 51627 | BRD-K71350836 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 97133 | BRD-K71350836 | A375 | 3.33 uM | 24 h | 0.23 | 0.94 | 0.06 | 0.0 | 0.0 | 0.0 |
| 97201 | BRD-K71350836 | PC3 | 1.11 uM | 24 h | 0.21 | 0.87 | 0.01 | -0.27 | -0.9 | 0.28 |