CMap Candidate Details
Structure:
| CMap ID: | C00959 |
| Pert ID: | BRD-K43806473 |
| Compound Name: | camostat-mesilate |
| Targets: | PRSS1 |
| MoA: | protease inhibitor |
| SMILES: | CN(C)C(=O)COC(=O)Cc1ccc(OC(=O)c2ccc(NC(N)=N)cc2)cc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 121556 | BRD-K43806473 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121595 | BRD-K43806473 | HA1E | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121657 | BRD-K43806473 | HT29 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.29 | -0.98 | 0.47 |
| 121676 | BRD-K43806473 | MCF??7.00 | 10 uM | 24 h | 0.23 | 0.94 | 0.06 | 0.0 | 0.0 | 0.0 |
| 129601 | BRD-K43806473 | HELA | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.41 | 1.46 | 2.23 |
| 129686 | BRD-K43806473 | PC3 | 0.01 uM | 24 h | 0.23 | 0.97 | 0.08 | 0.32 | 1.12 | 0.77 |
| 129724 | BRD-K43806473 | YAPC | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.28 | -0.94 | 0.38 |