CMap Candidate Details
Structure:
| CMap ID: | C00965 |
| Pert ID: | BRD-K84091759 |
| Compound Name: | candesartan |
| Targets: | AGTR1 |
| MoA: | angiotensin receptor antagonist |
| SMILES: | CCOc1nc2cccc(C(O)=O)c2n1Cc1ccc(cc1)-c1ccccc1-c1nnn[nH]1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 52203 | BRD-K84091759 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 91138 | BRD-K84091759 | HUH7 | 8 uM | 72 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 95313 | BRD-K84091759 | A549 | 10 uM | 48 h | 0.0 | 0.0 | 0.0 | -0.31 | -1.05 | 0.7 |
| 95455 | BRD-K84091759 | U2OS | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 126009 | BRD-K84091759 | HA1E | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 126088 | BRD-K84091759 | HUVEC | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 126135 | BRD-K84091759 | JURKAT | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.22 | -0.75 | 0.07 |
| 126188 | BRD-K84091759 | MCF10A | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.32 | 1.15 | 0.88 |
| 126268 | BRD-K84091759 | PC3 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 126306 | BRD-K84091759 | THP1 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 126344 | BRD-K84091759 | YAPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134012 | BRD-K84091759 | A375 | 0.03 uM | 24 h | 0.21 | 0.86 | 0.01 | 0.27 | 0.94 | 0.3 |
| 134110 | BRD-K84091759 | HEK293 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.33 | -1.11 | 0.9 |
| 134155 | BRD-K84091759 | HELA | 0.01 uM | 24 h | 0.2 | 0.85 | 0.01 | 0.0 | 0.0 | 0.0 |
| 134185 | BRD-K84091759 | HT29 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134263 | BRD-K84091759 | MDAMB231 | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.32 | 1.13 | 0.85 |