CMap Candidate Details
Structure:
| CMap ID: | C01002 |
| Pert ID: | BRD-K99174507 |
| Compound Name: | cardiogenol-c |
| Targets: | |
| MoA: | cardiomyogenesis inducer |
| SMILES: | COc1ccc(Nc2nccc(NCCO)n2)cc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 1676 | BRD-K99174507 | HA1E | 10 uM | 24 h | -0.21 | -0.89 | 0.04 | 0.0 | 0.0 | 0.0 |
| 2024 | BRD-K99174507 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 2455 | BRD-K99174507 | PC3 | 10 uM | 6 h | -0.24 | -1.01 | 0.17 | 0.0 | 0.0 | 0.0 |
| 2482 | BRD-K99174507 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 41860 | BRD-K99174507 | A375 | 10 uM | 6 h | 0.15 | 0.61 | 0.0 | -0.31 | -1.05 | 0.68 |
| 42160 | BRD-K99174507 | A549 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 42505 | BRD-K99174507 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.3 | 1.05 | 0.58 |
| 42814 | BRD-K99174507 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.25 | 0.9 | 0.22 |
| 43099 | BRD-K99174507 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 43248 | BRD-K99174507 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 43679 | BRD-K99174507 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.34 | 1.19 | 1.03 |
| 43979 | BRD-K99174507 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 44227 | BRD-K99174507 | SKB | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |