CMap Candidate Details
Structure:
| CMap ID: | C01074 |
| Pert ID: | BRD-K15766189 |
| Compound Name: | cefdinir |
| Targets: | MPO |
| MoA: | bacterial cell wall synthesis inhibitor |
| SMILES: | Nc1nc(cs1)C(=N\O)\C(=O)N[C@H]1[C@H]2SCC(C=C)=C(N2C1=O)C(O)=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 100139 | BRD-K15766189 | U2OS | 10 uM | 6 h | 0.24 | 1.02 | 0.13 | 0.0 | 0.0 | 0.0 |
| 120229 | BRD-K15766189 | A375 | 0.04 uM | 24 h | 0.25 | 1.03 | 0.13 | 0.0 | 0.0 | 0.0 |
| 120263 | BRD-K15766189 | A549 | 0.04 uM | 24 h | 0.25 | 1.02 | 0.13 | 0.0 | 0.0 | 0.0 |
| 120357 | BRD-K15766189 | HELA | 1.11 uM | 3 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120394 | BRD-K15766189 | MCF??7.00 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120456 | BRD-K15766189 | YAPC | 10 uM | 24 h | 0.25 | 1.04 | 0.15 | 0.0 | 0.0 | 0.0 |
| 128901 | BRD-K15766189 | HA1E | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.35 | -1.17 | 1.11 |
| 128936 | BRD-K15766189 | HT29 | 0.74 uM | 24 h | -0.19 | -0.81 | 0.0 | 0.0 | 0.0 | 0.0 |
| 128969 | BRD-K15766189 | PC3 | 2.22 uM | 24 h | -0.2 | -0.83 | 0.0 | 0.0 | 0.0 | 0.0 |