CMap Candidate Details
Structure:
| CMap ID: | C01076 |
| Pert ID: | BRD-A12077521 |
| Compound Name: | cefepime |
| Targets: | |
| MoA: | bacterial cell wall synthesis inhibitor |
| SMILES: | CO\N=C(\C(=O)NC1C2SCC(C[N+]3(C)CCCC3)=C(N2C1=O)C(O)=O)c1csc(N)n1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 122232 | BRD-A12077521 | A375 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.29 | 1.01 | 0.46 |
| 122309 | BRD-A12077521 | HEK293 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 122350 | BRD-A12077521 | MCF10A | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.17 | -0.58 | 0.0 |
| 122379 | BRD-A12077521 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 122431 | BRD-A12077521 | PC3 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 122454 | BRD-A12077521 | THP1 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.23 | -0.77 | 0.08 |
| 130546 | BRD-A12077521 | A549 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.36 | 1.29 | 1.46 |
| 130577 | BRD-A12077521 | HA1E | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130647 | BRD-A12077521 | HELA | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130687 | BRD-A12077521 | HT29 | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.2 | -0.68 | 0.02 |
| 130772 | BRD-A12077521 | MDAMB231 | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130824 | BRD-A12077521 | YAPC | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.38 | -1.27 | 1.39 |