CMap Candidate Details
Structure:
| CMap ID: | C01173 |
| Pert ID: | BRD-K29458283 |
| Compound Name: | chlorambucil |
| Targets: | |
| MoA: | DNA inhibitor |
| SMILES: | OC(=O)CCCc1ccc(cc1)N(CCCl)CCCl |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 5603 | BRD-K29458283 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.29 | -0.97 | 0.46 |
| 5897 | BRD-K29458283 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 37629 | BRD-K29458283 | ASC | 10 uM | 24 h | -0.23 | -0.95 | 0.09 | -0.34 | -1.16 | 1.11 |
| 38456 | BRD-K29458283 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 38705 | BRD-K29458283 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.34 | -1.14 | 1.05 |
| 51022 | BRD-K29458283 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 52026 | BRD-K29458283 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 52282 | BRD-K29458283 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 91438 | BRD-K29458283 | HUH7 | 10 uM | 72 h | 0.0 | 0.0 | 0.0 | -0.25 | -0.84 | 0.17 |
| 121889 | BRD-K29458283 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121915 | BRD-K29458283 | A549 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 122041 | BRD-K29458283 | HUVEC | 10 uM | 24 h | 0.24 | 1.0 | 0.1 | 0.0 | 0.0 | 0.0 |
| 122136 | BRD-K29458283 | MDAMB231 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 122187 | BRD-K29458283 | THP1 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 122215 | BRD-K29458283 | YAPC | 10 uM | 24 h | 0.33 | 1.39 | 1.02 | 0.0 | 0.0 | 0.0 |
| 130221 | BRD-K29458283 | HA1E | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130253 | BRD-K29458283 | HEK293 | 2.22 uM | 24 h | 0.2 | 0.84 | 0.0 | -0.19 | -0.65 | 0.01 |
| 130283 | BRD-K29458283 | HELA | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130315 | BRD-K29458283 | HT29 | 0.01 uM | 24 h | -0.22 | -0.91 | 0.05 | 0.0 | 0.0 | 0.0 |
| 130392 | BRD-K29458283 | MCF10A | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.28 | 0.98 | 0.37 |