CMap Candidate Details
Structure:
| CMap ID: | C01186 |
| Pert ID: | BRD-A20348246 |
| Compound Name: | chlormezanone |
| Targets: | GABRA1|TSPO |
| MoA: | GABA receptor modulator |
| SMILES: | CN1C(c2ccc(Cl)cc2)S(=O)(=O)CCC1=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 127758 | BRD-A20348246 | A375 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127802 | BRD-A20348246 | A549 | 0.04 uM | 24 h | -0.28 | -1.15 | 0.44 | 0.27 | 0.97 | 0.35 |
| 127834 | BRD-A20348246 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127887 | BRD-A20348246 | HEK293 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.27 | -0.9 | 0.29 |
| 127908 | BRD-A20348246 | HT29 | 0.04 uM | 24 h | -0.33 | -1.39 | 1.09 | 0.33 | 1.16 | 0.91 |
| 127961 | BRD-A20348246 | HUVEC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.28 | 0.98 | 0.38 |
| 128011 | BRD-A20348246 | MCF10A | 0.04 uM | 24 h | -0.27 | -1.14 | 0.42 | 0.0 | 0.0 | 0.0 |
| 135587 | BRD-A20348246 | HELA | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 135679 | BRD-A20348246 | JURKAT | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.3 | 1.06 | 0.58 |
| 135706 | BRD-A20348246 | MCF??7.00 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 135729 | BRD-A20348246 | PC3 | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 135750 | BRD-A20348246 | YAPC | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |