CMap Candidate Details
Structure:
| CMap ID: | C01197 |
| Pert ID: | BRD-K88682005 |
| Compound Name: | chlorothiazide |
| Targets: | CA1|CA2|CA4|SLC12A3 |
| MoA: | diuretic |
| SMILES: | NS(=O)(=O)c1cc2c(cc1Cl)N=CNS2(=O)=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 51281 | BRD-K88682005 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 51529 | BRD-K88682005 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |