CMap Candidate Details
Structure:
| CMap ID: | C01220 |
| Pert ID: | BRD-A72390365 |
| Compound Name: | choline-alfoscerate |
| Targets: | GM2A |
| MoA: | acetylcholine precursor |
| SMILES: | C[N+](C)(C)CCOP(O)(=O)OC[C@H](O)CO |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 126382 | BRD-A72390365 | A549 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 126443 | BRD-A72390365 | HEK293 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.29 | -0.98 | 0.48 |
| 126523 | BRD-A72390365 | MCF10A | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 126540 | BRD-A72390365 | MCF??7.00 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 126580 | BRD-A72390365 | PC3 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134351 | BRD-A72390365 | A375 | 0.03 uM | 24 h | -0.22 | -0.94 | 0.07 | 0.34 | 1.19 | 1.01 |
| 134402 | BRD-A72390365 | HA1E | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134431 | BRD-A72390365 | HELA | 0.25 uM | 24 h | 0.29 | 1.22 | 0.48 | -0.23 | -0.77 | 0.08 |
| 134466 | BRD-A72390365 | HT29 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134509 | BRD-A72390365 | HUVEC | 0.25 uM | 24 h | 0.27 | 1.11 | 0.25 | 0.22 | 0.79 | 0.07 |
| 134602 | BRD-A72390365 | MDAMB231 | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134653 | BRD-A72390365 | YAPC | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.28 | -0.93 | 0.35 |