CMap Candidate Details
Structure:
| CMap ID: | C01255 |
| Pert ID: | BRD-A75514485 |
| Compound Name: | CIM-0216 |
| Targets: | TRPM3 |
| MoA: | transient receptor potential channel agonist |
| SMILES: | Cc1cc(NC(=O)C(N2CCCc3ccccc23)c2ccccc2)no1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|