CMap Candidate Details
Structure:
| CMap ID: | C00128 |
| Pert ID: | BRD-K40718343 |
| Compound Name: | AEE788 |
| Targets: | EGFR|ERBB2|ERBB4|FGFR2|FGFR3|KDR |
| MoA: | EGFR inhibitor; VEGFR inhibitor |
| SMILES: | CCN1CCN(Cc2ccc(cc2)-c2cc3c(N[C@H](C)c4ccccc4)ncnc3[nH]2)CC1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 121555 | BRD-K40718343 | A375 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.3 | 1.08 | 0.65 |
| 121594 | BRD-K40718343 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.42 | 1.5 | 2.27 |
| 121633 | BRD-K40718343 | HELA | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.34 | -1.13 | 0.99 |
| 121656 | BRD-K40718343 | HT29 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121675 | BRD-K40718343 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.17 | 0.6 | 0.0 |
| 129685 | BRD-K40718343 | PC3 | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129723 | BRD-K40718343 | YAPC | 2.22 uM | 24 h | 0.27 | 1.12 | 0.27 | 0.0 | 0.0 | 0.0 |