CMap Candidate Details
Structure:
| CMap ID: | C01293 |
| Pert ID: | BRD-A47598013 |
| Compound Name: | citalopram |
| Targets: | SLC6A2|SLC6A4 |
| MoA: | selective serotonin reuptake inhibitor (SSRI) |
| SMILES: | CN(C)CCCC1(OCc2cc(ccc12)C#N)c1ccc(F)cc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 1448 | BRD-A47598013 | NPC | 6.66 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7548 | BRD-A47598013 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 19387 | BRD-A47598013 | A549 | 10 uM | 6 h | 0.23 | 0.95 | 0.06 | -0.37 | -1.24 | 1.35 |
| 19552 | BRD-A47598013 | HA1E | 10 uM | 6 h | 0.16 | 0.68 | 0.0 | 0.0 | 0.0 | 0.0 |
| 20202 | BRD-A47598013 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 20835 | BRD-A47598013 | MCF??7.00 | 10 uM | 24 h | 0.21 | 0.86 | 0.01 | 0.25 | 0.9 | 0.21 |
| 25297 | BRD-A47598013 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 91467 | BRD-A47598013 | HUH7 | 10 uM | 72 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 100183 | BRD-A47598013 | U2OS | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124568 | BRD-A47598013 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.36 | 1.28 | 1.42 |
| 124679 | BRD-A47598013 | HT29 | 0.04 uM | 24 h | 0.28 | 1.17 | 0.37 | 0.0 | 0.0 | 0.0 |
| 124780 | BRD-A47598013 | MDAMB231 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124825 | BRD-A47598013 | PC3 | 0.04 uM | 24 h | 0.25 | 1.05 | 0.17 | 0.25 | 0.89 | 0.2 |
| 124869 | BRD-A47598013 | THP1 | 3.33 uM | 24 h | -0.28 | -1.18 | 0.5 | 0.0 | 0.0 | 0.0 |
| 132739 | BRD-A47598013 | HEK293 | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.36 | -1.2 | 1.19 |
| 132780 | BRD-A47598013 | HELA | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.43 | 1.52 | 2.29 |
| 132825 | BRD-A47598013 | JURKAT | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 132857 | BRD-A47598013 | MCF10A | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 132942 | BRD-A47598013 | YAPC | 0.25 uM | 24 h | -0.21 | -0.86 | 0.02 | 0.0 | 0.0 | 0.0 |