CMap Candidate Details
Structure:
| CMap ID: | C01294 |
| Pert ID: | BRD-K53263234 |
| Compound Name: | CITCO |
| Targets: | NR1I3 |
| MoA: | constitutive androstane receptor (CAR) agonist |
| SMILES: | Clc1ccc(cc1)-c1nc2sccn2c1\C=N\OCc1ccc(Cl)c(Cl)c1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 6779 | BRD-K53263234 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7010 | BRD-K53263234 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7341 | BRD-K53263234 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7890 | BRD-K53263234 | HT29 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.29 | 1.04 | 0.53 |
| 8209 | BRD-K53263234 | MCF??7.00 | 10 uM | 6 h | -0.18 | -0.76 | 0.0 | 0.23 | 0.82 | 0.1 |
| 8389 | BRD-K53263234 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 8829 | BRD-K53263234 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 98816 | BRD-K53263234 | NPC | 10 uM | 6 h | -0.27 | -1.13 | 0.4 | -0.32 | -1.07 | 0.76 |
| 98909 | BRD-K53263234 | NEU | 10 uM | 24 h | 0.26 | 1.07 | 0.19 | 0.3 | 1.07 | 0.63 |
| 99645 | BRD-K53263234 | U2OS | 12 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |