CMap Candidate Details
Structure:
| CMap ID: | C01314 |
| Pert ID: | BRD-A61676498 |
| Compound Name: | climbazole |
| Targets: | |
| MoA: | enzyme inducer |
| SMILES: | CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 91471 | BRD-A61676498 | HUH7 | 12 uM | 72 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 123529 | BRD-A61676498 | HA1E | 0.125 uM | 24 h | 0.24 | 1.01 | 0.11 | 0.0 | 0.0 | 0.0 |
| 123551 | BRD-A61676498 | HEK293 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 123606 | BRD-A61676498 | HELA | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 123671 | BRD-A61676498 | MCF10A | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.28 | 0.99 | 0.4 |
| 123719 | BRD-A61676498 | MCF??7.00 | 10 uM | 24 h | -0.2 | -0.83 | 0.0 | -0.26 | -0.86 | 0.22 |
| 123754 | BRD-A61676498 | YAPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 131965 | BRD-A61676498 | A375 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 132054 | BRD-A61676498 | HT29 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 132098 | BRD-A61676498 | PC3 | 0.08 uM | 24 h | 0.21 | 0.88 | 0.02 | 0.24 | 0.87 | 0.17 |