CMap Candidate Details
Structure:
| CMap ID: | C00133 |
| Pert ID: | BRD-K69247067 |
| Compound Name: | afloqualone |
| Targets: | |
| MoA: | acetylcholine receptor antagonist |
| SMILES: | Cc1ccccc1-n1c(CF)nc2ccc(N)cc2c1=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 126424 | BRD-K69247067 | HEK293 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.24 | 0.86 | 0.16 |
| 126515 | BRD-K69247067 | MCF10A | 0.37 uM | 24 h | -0.22 | -0.91 | 0.05 | -0.32 | -1.08 | 0.79 |
| 126532 | BRD-K69247067 | MCF??7.00 | 3.33 uM | 24 h | 0.24 | 0.98 | 0.09 | -0.31 | -1.04 | 0.66 |
| 126572 | BRD-K69247067 | PC3 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.34 | -1.14 | 1.03 |
| 134341 | BRD-K69247067 | A375 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134369 | BRD-K69247067 | A549 | 2.22 uM | 24 h | 0.28 | 1.18 | 0.39 | -0.27 | -0.89 | 0.27 |
| 134392 | BRD-K69247067 | HA1E | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134422 | BRD-K69247067 | HELA | 0.74 uM | 24 h | -0.32 | -1.32 | 0.83 | 0.34 | 1.19 | 1.01 |
| 134454 | BRD-K69247067 | HT29 | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.35 | 1.25 | 1.29 |
| 134491 | BRD-K69247067 | HUVEC | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134590 | BRD-K69247067 | MDAMB231 | 0.08 uM | 24 h | 0.35 | 1.46 | 1.12 | 0.0 | 0.0 | 0.0 |
| 134647 | BRD-K69247067 | YAPC | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.3 | -1.02 | 0.61 |