CMap Candidate Details
Structure:
| CMap ID: | C01363 |
| Pert ID: | BRD-K55677650 |
| Compound Name: | CO-101244 |
| Targets: | GRIN2B |
| MoA: | glutamate receptor antagonist |
| SMILES: | Cc1ccc(CC2(O)CCN(CCOc3ccc(O)cc3)CC2)cc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 6785 | BRD-K55677650 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7016 | BRD-K55677650 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7468 | BRD-K55677650 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7691 | BRD-K55677650 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.26 | 0.9 | 0.23 |
| 8016 | BRD-K55677650 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 8155 | BRD-K55677650 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.33 | 1.18 | 0.98 |
| 8523 | BRD-K55677650 | PC3 | 10 uM | 6 h | -0.3 | -1.23 | 0.64 | 0.0 | 0.0 | 0.0 |
| 8834 | BRD-K55677650 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |