CMap Candidate Details
Structure:
| CMap ID: | C00137 |
| Pert ID: | BRD-K08310154 |
| Compound Name: | AG-1024 |
| Targets: | IGF1R |
| MoA: | insulin growth factor receptor inhibitor |
| SMILES: | CC(C)(C)c1cc(C=C(C#N)C#N)cc(Br)c1O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 90837 | BRD-K08310154 | MCF10A | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |