CMap Candidate Details
Structure:
| CMap ID: | C01408 |
| Pert ID: | BRD-K19171642 |
| Compound Name: | CP-91149 |
| Targets: | PYGL |
| MoA: | glycogen phosphorylase inhibitor |
| SMILES: | CN(C)C(=O)[C@H](O)[C@H](Cc1ccccc1)NC(=O)c1cc2cc(Cl)ccc2[nH]1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 96350 | BRD-K19171642 | A375 | 10 uM | 24 h | -0.37 | -1.52 | 1.43 | -0.29 | -0.96 | 0.44 |
| 96421 | BRD-K19171642 | PC3 | 10 uM | 24 h | -0.24 | -1.01 | 0.16 | -0.36 | -1.21 | 1.22 |