CMap Candidate Details
Structure:
| CMap ID: | C00142 |
| Pert ID: | BRD-A56371469 |
| Compound Name: | AGI-5198 |
| Targets: | IDH1 |
| MoA: | isocitrate dehydrogenase inhibitor |
| SMILES: | Cc1nccn1CC(=O)N(C(C(=O)NC1CCCCC1)c1ccccc1C)c1cccc(F)c1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 123519 | BRD-A56371469 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 123541 | BRD-A56371469 | HA1E | 3.33 uM | 24 h | -0.22 | -0.91 | 0.05 | 0.39 | 1.38 | 2.17 |
| 123579 | BRD-A56371469 | HEK293 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 123654 | BRD-A56371469 | HT29 | 3.33 uM | 24 h | -0.28 | -1.15 | 0.44 | -0.19 | -0.65 | 0.01 |
| 123696 | BRD-A56371469 | MCF10A | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.34 | -1.14 | 1.01 |
| 123768 | BRD-A56371469 | YAPC | 10 uM | 24 h | 0.19 | 0.81 | 0.0 | -0.28 | -0.95 | 0.4 |
| 132041 | BRD-A56371469 | HELA | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.39 | -1.3 | 1.66 |
| 132087 | BRD-A56371469 | MCF??7.00 | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 132118 | BRD-A56371469 | PC3 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.19 | -0.66 | 0.01 |