CMap Candidate Details
Structure:
| CMap ID: | C01577 |
| Pert ID: | BRD-K43578482 |
| Compound Name: | defactinib |
| Targets: | PTK2 |
| MoA: | focal adhesion kinase inhibitor |
| SMILES: | CNC(=O)c1ccc(Nc2ncc(c(NCc3nccnc3N(C)S(C)(=O)=O)n2)C(F)(F)F)cc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 123296 | BRD-K43578482 | HEK293 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.3 | -1.0 | 0.54 |
| 123324 | BRD-K43578482 | HELA | 3.33 uM | 24 h | -0.21 | -0.86 | 0.02 | 0.22 | 0.77 | 0.05 |
| 123356 | BRD-K43578482 | HT29 | 3.33 uM | 24 h | -0.23 | -0.95 | 0.09 | 0.26 | 0.91 | 0.23 |
| 123438 | BRD-K43578482 | PC3 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.25 | 0.9 | 0.22 |
| 123473 | BRD-K43578482 | THP1 | 3.33 uM | 24 h | -0.25 | -1.04 | 0.21 | -0.34 | -1.16 | 1.11 |
| 123508 | BRD-K43578482 | YAPC | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 131535 | BRD-K43578482 | A375 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 131563 | BRD-K43578482 | A549 | 2.22 uM | 24 h | -0.24 | -0.98 | 0.13 | -0.24 | -0.79 | 0.11 |
| 131602 | BRD-K43578482 | HA1E | 2.22 uM | 24 h | -0.22 | -0.9 | 0.04 | 0.0 | 0.0 | 0.0 |
| 131745 | BRD-K43578482 | HUVEC | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 131800 | BRD-K43578482 | JURKAT | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.37 | -1.26 | 1.35 |
| 131833 | BRD-K43578482 | MCF10A | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 131873 | BRD-K43578482 | MCF??7.00 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 131905 | BRD-K43578482 | MDAMB231 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.24 | -0.8 | 0.12 |