CMap Candidate Details
Structure:
| CMap ID: | C01598 |
| Pert ID: | BRD-K51471001 |
| Compound Name: | demecarium |
| Targets: | ACHE|BCHE |
| MoA: | acetylcholinesterase inhibitor |
| SMILES: | CN(CCCCCCCCCCN(C)C(=O)Oc1cccc(c1)[N+](C)(C)C)C(=O)Oc1cccc(c1)[N+](C)(C)C |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 51731 | BRD-K51471001 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.28 | -0.94 | 0.36 |
| 96991 | BRD-K51471001 | A375 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 97069 | BRD-K51471001 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |