CMap Candidate Details
Structure:
| CMap ID: | C01626 |
| Pert ID: | BRD-K39462424 |
| Compound Name: | dexchlorpheniramine |
| Targets: | |
| MoA: | histamine receptor antagonist |
| SMILES: | CN(C)CC[C@@H](c1ccc(Cl)cc1)c1ccccn1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 22488 | BRD-K39462424 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.26 | -0.89 | 0.26 |
| 22763 | BRD-K39462424 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 23052 | BRD-K39462424 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 23575 | BRD-K39462424 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 23996 | BRD-K39462424 | PC3 | 10 uM | 6 h | -0.24 | -1.01 | 0.15 | 0.33 | 1.17 | 0.92 |
| 24310 | BRD-K39462424 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |