CMap Candidate Details
Structure:
| CMap ID: | C01641 |
| Pert ID: | BRD-K06014311 |
| Compound Name: | DH-97 |
| Targets: | MTNR1B |
| MoA: | melatonin receptor antagonist |
| SMILES: | CCCCC(=O)NCCc1c(Cc2ccccc2)[nH]c2ccccc12 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 4187 | BRD-K06014311 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.32 | -1.06 | 0.73 |
| 4345 | BRD-K06014311 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 4639 | BRD-K06014311 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 5024 | BRD-K06014311 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.33 | -1.1 | 0.86 |
| 44285 | BRD-K06014311 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 44512 | BRD-K06014311 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.38 | -1.28 | 1.45 |
| 44828 | BRD-K06014311 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 45140 | BRD-K06014311 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 45408 | BRD-K06014311 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 45639 | BRD-K06014311 | MCF??7.00 | 10 uM | 24 h | -0.19 | -0.81 | 0.0 | 0.0 | 0.0 | 0.0 |
| 45943 | BRD-K06014311 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.29 | 1.03 | 0.51 |
| 46263 | BRD-K06014311 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 46579 | BRD-K06014311 | SKB | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 100004 | BRD-K06014311 | U2OS | 10 uM | 6 h | 0.18 | 0.77 | 0.0 | 0.0 | 0.0 | 0.0 |