CMap Candidate Details
Structure:
| CMap ID: | C01647 |
| Pert ID: | BRD-A27143604 |
| Compound Name: | diarylpropionitrile |
| Targets: | ESR2 |
| MoA: | estrogen receptor agonist |
| SMILES: | Oc1ccc(CC(C#N)c2ccc(O)cc2)cc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 1489 | BRD-A27143604 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 2034 | BRD-A27143604 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 2327 | BRD-A27143604 | PC3 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.24 | 0.85 | 0.15 |
| 2596 | BRD-A27143604 | VCAP | 10 uM | 24 h | -0.21 | -0.86 | 0.02 | -0.37 | -1.24 | 1.35 |
| 41657 | BRD-A27143604 | A375 | 10 uM | 6 h | -0.23 | -0.94 | 0.08 | -0.21 | -0.7 | 0.03 |
| 41876 | BRD-A27143604 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 42192 | BRD-A27143604 | ASC | 10 uM | 24 h | 0.22 | 0.93 | 0.05 | 0.0 | 0.0 | 0.0 |
| 42536 | BRD-A27143604 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 42843 | BRD-A27143604 | HT29 | 10 uM | 6 h | 0.28 | 1.16 | 0.36 | 0.0 | 0.0 | 0.0 |
| 43119 | BRD-A27143604 | MCF??7.00 | 10 uM | 24 h | 0.3 | 1.23 | 0.5 | 0.26 | 0.91 | 0.24 |
| 43392 | BRD-A27143604 | NPC | 10 uM | 24 h | -0.27 | -1.12 | 0.39 | -0.3 | -1.01 | 0.57 |
| 43706 | BRD-A27143604 | PHH | 10 uM | 24 h | 0.33 | 1.38 | 1.01 | -0.2 | -0.67 | 0.02 |