CMap Candidate Details
Structure:
| CMap ID: | C01661 |
| Pert ID: | BRD-A06426627 |
| Compound Name: | diclazuril |
| Targets: | |
| MoA: | antiprotozoal agent |
| SMILES: | Clc1ccc(cc1)C(C#N)c1c(Cl)cc(cc1Cl)-n1ncc(=O)[nH]c1=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 91153 | BRD-A06426627 | HUH7 | 8 uM | 72 h | 0.0 | 0.0 | 0.0 | -0.3 | -1.01 | 0.57 |