CMap Candidate Details
Structure:
| CMap ID: | C01671 |
| Pert ID: | BRD-K84794093 |
| Compound Name: | dideoxyadenosine |
| Targets: | |
| MoA: | nucleoside reverse transcriptase inhibitor |
| SMILES: | Nc1ncnc2n(cnc12)[C@H]1CC[C@@H](CO)O1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 125987 | BRD-K84794093 | A549 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.27 | -0.92 | 0.33 |
| 126011 | BRD-K84794093 | HA1E | 10 uM | 24 h | 0.21 | 0.88 | 0.01 | 0.0 | 0.0 | 0.0 |
| 126035 | BRD-K84794093 | HELA | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 126140 | BRD-K84794093 | JURKAT | 0.37 uM | 24 h | 0.24 | 1.02 | 0.13 | 0.32 | 1.12 | 0.76 |
| 126193 | BRD-K84794093 | MCF10A | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 126311 | BRD-K84794093 | THP1 | 0.125 uM | 24 h | -0.23 | -0.97 | 0.11 | 0.0 | 0.0 | 0.0 |
| 134015 | BRD-K84794093 | A375 | 0.74 uM | 24 h | -0.26 | -1.09 | 0.33 | 0.31 | 1.09 | 0.67 |
| 134114 | BRD-K84794093 | HEK293 | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134188 | BRD-K84794093 | HT29 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134210 | BRD-K84794093 | HUVEC | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134234 | BRD-K84794093 | MCF??7.00 | 2.22 uM | 24 h | -0.25 | -1.02 | 0.19 | 0.3 | 1.05 | 0.58 |
| 134268 | BRD-K84794093 | MDAMB231 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134291 | BRD-K84794093 | PC3 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134322 | BRD-K84794093 | YAPC | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |