CMap Candidate Details
Structure:
| CMap ID: | C01689 |
| Pert ID: | BRD-K31471398 |
| Compound Name: | dihydrexidine |
| Targets: | DRD1|DRD2|DRD3|DRD4|DRD5 |
| MoA: | dopamine receptor agonist |
| SMILES: | Oc1cc2CC[C@H]3NCc4ccccc4[C@@H]3c2cc1O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 22071 | BRD-K31471398 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 22277 | BRD-K31471398 | A549 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 22472 | BRD-K31471398 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 22745 | BRD-K31471398 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 23032 | BRD-K31471398 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.26 | 0.91 | 0.23 |
| 23334 | BRD-K31471398 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 23718 | BRD-K31471398 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 23986 | BRD-K31471398 | PC3 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 24304 | BRD-K31471398 | VCAP | 10 uM | 6 h | 0.19 | 0.81 | 0.0 | -0.31 | -1.05 | 0.68 |